C31H30N2O3 — CID 11420196
(E)-3-[1-cyclohexyl-4-phenyl-5-(4-phenylmethoxyphenyl)pyrazol-3-yl]prop-2-enoic acid (PubChem CID 11420196) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is (E)-3-[1-cyclohexyl-4-phenyl-5-(4-phenylmethoxyphenyl)pyrazol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-cyclohexyl-4-phenyl-5-(4-phenylmethoxyphenyl)pyrazol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11420196 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (E)-3-[1-cyclohexyl-4-phenyl-5-(4-phenylmethoxyphenyl)pyrazol-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nn(C2CCCCC2)c(-c2ccc(OCc3ccccc3)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C31H30N2O3/c34-29(35)21-20-28-30(24-12-6-2-7-13-24)31(33(32-28)26-14-8-3-9-15-26)25-16-18-27(19-17-25)36-22-23-10-4-1-5-11-23/h1-2,4-7,10-13,16-21,26H,3,8-9,14-15,22H2,(H,34,35)/b21-20+ |
| InChIKey | VYELRUUMVSXCEN-QZQOTICOSA-N |
| XLogP | 7.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|