C13H15BrN4S — CID 114203372
4-(3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine (PubChem CID 114203372) has the molecular formula C13H15BrN4S and a molecular weight of 339.26 g/mol. Its IUPAC name is 4-(3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine.
| Compound Name | 4-(3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 114203372 |
| Molecular Formula | C13H15BrN4S |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4-(3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine |
| SMILES | Cc1nsc2ncnc(N3C4CCC3CC(Br)C4)c12 |
| InChI | InChI=1S/C13H15BrN4S/c1-7-11-12(15-6-16-13(11)19-17-7)18-9-2-3-10(18)5-8(14)4-9/h6,8-10H,2-5H2,1H3 |
| InChIKey | NBROKAYPFPXRLX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|