C12H14N4OS — CID 114203358
1-(3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carbaldehyde (PubChem CID 114203358) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 1-(3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carbaldehyde.
| Compound Name | 1-(3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 114203358 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-yl)piperidine-4-carbaldehyde |
| SMILES | Cc1nsc2ncnc(N3CCC(C=O)CC3)c12 |
| InChI | InChI=1S/C12H14N4OS/c1-8-10-11(13-7-14-12(10)18-15-8)16-4-2-9(6-17)3-5-16/h6-7,9H,2-5H2,1H3 |
| InChIKey | SERAKJVRFDGANF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|