C13H17BrN4S — CID 114203388
4-[4-(1-bromoethyl)piperidin-1-yl]-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine (PubChem CID 114203388) has the molecular formula C13H17BrN4S and a molecular weight of 341.28 g/mol. Its IUPAC name is 4-[4-(1-bromoethyl)piperidin-1-yl]-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine.
| Compound Name | 4-[4-(1-bromoethyl)piperidin-1-yl]-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 114203388 |
| Molecular Formula | C13H17BrN4S |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 4-[4-(1-bromoethyl)piperidin-1-yl]-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine |
| SMILES | Cc1nsc2ncnc(N3CCC(C(C)Br)CC3)c12 |
| InChI | InChI=1S/C13H17BrN4S/c1-8(14)10-3-5-18(6-4-10)12-11-9(2)17-19-13(11)16-7-15-12/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | NLBAWIDMCCJWDZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|