C12H16BrN3O2 — CID 114205536
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-(bromomethyl)-1H-pyrimidin-6-one (PubChem CID 114205536) has the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-(bromomethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-(bromomethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114205536 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-(bromomethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2CN3CCCC3CO2)ncc1CBr |
| InChI | InChI=1S/C12H16BrN3O2/c13-4-8-5-14-11(15-12(8)17)10-6-16-3-1-2-9(16)7-18-10/h5,9-10H,1-4,6-7H2,(H,14,15,17) |
| InChIKey | IHCASLUOORLZJO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|