C12H18N4O2 — CID 113385095
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-(aminomethyl)-1H-pyrimidin-6-one (PubChem CID 113385095) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-(aminomethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-(aminomethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 113385095 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-(aminomethyl)-1H-pyrimidin-6-one |
| SMILES | NCc1cnc(C2CN3CCCC3CO2)[nH]c1=O |
| InChI | InChI=1S/C12H18N4O2/c13-4-8-5-14-11(15-12(8)17)10-6-16-3-1-2-9(16)7-18-10/h5,9-10H,1-4,6-7,13H2,(H,14,15,17) |
| InChIKey | BXAUFNFDDZPISO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |