C28H37N3O2 — CID 11421045
6-[4-(3-acetylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide (PubChem CID 11421045) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 6-[4-(3-acetylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide.
| Compound Name | 6-[4-(3-acetylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide |
|---|---|
| PubChem CID | 11421045 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 6-[4-(3-acetylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide |
| SMILES | CC(=O)c1cccc(N2CCN(CCCCCC(=O)NC3CCCc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C28H37N3O2/c1-22(32)24-11-7-12-25(21-24)31-19-17-30(18-20-31)16-6-2-3-15-28(33)29-27-14-8-10-23-9-4-5-13-26(23)27/h4-5,7,9,11-13,21,27H,2-3,6,8,10,14-20H2,1H3,(H,29,33) |
| InChIKey | FRXNQPUFVQPPJY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|