C28H40N4O — CID 23643870
6-[4-[2-(dimethylamino)phenyl]piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide (PubChem CID 23643870) has the molecular formula C28H40N4O and a molecular weight of 448.66 g/mol. Its IUPAC name is 6-[4-[2-(dimethylamino)phenyl]piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide.
| Compound Name | 6-[4-[2-(dimethylamino)phenyl]piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide |
|---|---|
| PubChem CID | 23643870 |
| Molecular Formula | C28H40N4O |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 6-[4-[2-(dimethylamino)phenyl]piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide |
| SMILES | CN(C)c1ccccc1N1CCN(CCCCCC(=O)NC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C28H40N4O/c1-30(2)26-15-7-8-16-27(26)32-21-19-31(20-22-32)18-9-3-4-17-28(33)29-25-14-10-12-23-11-5-6-13-24(23)25/h5-8,11,13,15-16,25H,3-4,9-10,12,14,17-22H2,1-2H3,(H,29,33) |
| InChIKey | AYPZPRUFAPTKJJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|