C13H21NO5 — CID 114210879
methyl 5-[1-[(1-hydroxy-4-methoxybutan-2-yl)amino]ethyl]furan-2-carboxylate (PubChem CID 114210879) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is methyl 5-[1-[(1-hydroxy-4-methoxybutan-2-yl)amino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[(1-hydroxy-4-methoxybutan-2-yl)amino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 114210879 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | methyl 5-[1-[(1-hydroxy-4-methoxybutan-2-yl)amino]ethyl]furan-2-carboxylate |
| SMILES | COCCC(CO)NC(C)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C13H21NO5/c1-9(14-10(8-15)6-7-17-2)11-4-5-12(19-11)13(16)18-3/h4-5,9-10,14-15H,6-8H2,1-3H3 |
| InChIKey | UDAJDRSFCOVYDL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |