C14H26F2O — CID 114215688
1-(3,3-difluorocyclohexyl)-3,5-dimethylhexan-1-ol (PubChem CID 114215688) has the molecular formula C14H26F2O and a molecular weight of 248.36 g/mol. Its IUPAC name is 1-(3,3-difluorocyclohexyl)-3,5-dimethylhexan-1-ol.
| Compound Name | 1-(3,3-difluorocyclohexyl)-3,5-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 114215688 |
| Molecular Formula | C14H26F2O |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-(3,3-difluorocyclohexyl)-3,5-dimethylhexan-1-ol |
| SMILES | CC(C)CC(C)CC(O)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H26F2O/c1-10(2)7-11(3)8-13(17)12-5-4-6-14(15,16)9-12/h10-13,17H,4-9H2,1-3H3 |
| InChIKey | KAYFTWOGPYKHQZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |