C9H12F2O — CID 130563414
(1R)-1-(3,3-difluorocyclohexyl)prop-2-yn-1-ol (PubChem CID 130563414) has the molecular formula C9H12F2O and a molecular weight of 174.19 g/mol. Its IUPAC name is (1R)-1-(3,3-difluorocyclohexyl)prop-2-yn-1-ol.
| Compound Name | (1R)-1-(3,3-difluorocyclohexyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 130563414 |
| Molecular Formula | C9H12F2O |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (1R)-1-(3,3-difluorocyclohexyl)prop-2-yn-1-ol |
| SMILES | C#C[C@H](O)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C9H12F2O/c1-2-8(12)7-4-3-5-9(10,11)6-7/h1,7-8,12H,3-6H2/t7?,8-/m0/s1 |
| InChIKey | HZXUGEOYIFGEHC-MQWKRIRWSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|