C11H19F2N — CID 130484946
cyclopentyl-(3,3-difluorocyclopentyl)methanamine (PubChem CID 130484946) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is cyclopentyl-(3,3-difluorocyclopentyl)methanamine.
| Compound Name | cyclopentyl-(3,3-difluorocyclopentyl)methanamine |
|---|---|
| PubChem CID | 130484946 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | cyclopentyl-(3,3-difluorocyclopentyl)methanamine |
| SMILES | NC(C1CCCC1)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H19F2N/c12-11(13)6-5-9(7-11)10(14)8-3-1-2-4-8/h8-10H,1-7,14H2 |
| InChIKey | PEPJMWZDCHMPGL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |