C8H15F2NO — CID 160689350
(2S)-2-amino-2-(3,3-difluorocyclohexyl)ethanol (PubChem CID 160689350) has the molecular formula C8H15F2NO and a molecular weight of 179.21 g/mol. Its IUPAC name is (2S)-2-amino-2-(3,3-difluorocyclohexyl)ethanol.
| Compound Name | (2S)-2-amino-2-(3,3-difluorocyclohexyl)ethanol |
|---|---|
| PubChem CID | 160689350 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (2S)-2-amino-2-(3,3-difluorocyclohexyl)ethanol |
| SMILES | N[C@H](CO)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C8H15F2NO/c9-8(10)3-1-2-6(4-8)7(11)5-12/h6-7,12H,1-5,11H2/t6?,7-/m1/s1 |
| InChIKey | SVLKNJSVOLFARQ-COBSHVIPSA-N |
| XLogP | 1.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |