C12H23N5O — CID 114222859
N-[(4-ethylmorpholin-2-yl)methyl]-3-propyltriazol-4-amine (PubChem CID 114222859) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is N-[(4-ethylmorpholin-2-yl)methyl]-3-propyltriazol-4-amine.
| Compound Name | N-[(4-ethylmorpholin-2-yl)methyl]-3-propyltriazol-4-amine |
|---|---|
| PubChem CID | 114222859 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | N-[(4-ethylmorpholin-2-yl)methyl]-3-propyltriazol-4-amine |
| SMILES | CCCn1nncc1NCC1CN(CC)CCO1 |
| InChI | InChI=1S/C12H23N5O/c1-3-5-17-12(9-14-15-17)13-8-11-10-16(4-2)6-7-18-11/h9,11,13H,3-8,10H2,1-2H3 |
| InChIKey | UVPZCBAULKCWTE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |