C10H18N6O — CID 114222991
1-(3-ethyltriazol-4-yl)-N-methylpiperazine-2-carboxamide (PubChem CID 114222991) has the molecular formula C10H18N6O and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(3-ethyltriazol-4-yl)-N-methylpiperazine-2-carboxamide.
| Compound Name | 1-(3-ethyltriazol-4-yl)-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 114222991 |
| Molecular Formula | C10H18N6O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-(3-ethyltriazol-4-yl)-N-methylpiperazine-2-carboxamide |
| SMILES | CCn1nncc1N1CCNCC1C(=O)NC |
| InChI | InChI=1S/C10H18N6O/c1-3-16-9(7-13-14-16)15-5-4-12-6-8(15)10(17)11-2/h7-8,12H,3-6H2,1-2H3,(H,11,17) |
| InChIKey | IDQCKXVOHIWHGO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |