C10H14IN5O2 — CID 136978451
1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N-methylpiperazine-2-carboxamide (PubChem CID 136978451) has the molecular formula C10H14IN5O2 and a molecular weight of 363.16 g/mol. Its IUPAC name is 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N-methylpiperazine-2-carboxamide.
| Compound Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 136978451 |
| Molecular Formula | C10H14IN5O2 |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N-methylpiperazine-2-carboxamide |
| SMILES | CNC(=O)C1CNCCN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H14IN5O2/c1-12-9(17)6-4-13-2-3-16(6)8-7(11)10(18)15-5-14-8/h5-6,13H,2-4H2,1H3,(H,12,17)(H,14,15,18) |
| InChIKey | CCPGHNDCIXKHCH-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|