C11H21N5O — CID 114223161
5-[(dimethylamino)methyl]-1-(3-ethyltriazol-4-yl)pyrrolidin-3-ol (PubChem CID 114223161) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-(3-ethyltriazol-4-yl)pyrrolidin-3-ol.
| Compound Name | 5-[(dimethylamino)methyl]-1-(3-ethyltriazol-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 114223161 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-(3-ethyltriazol-4-yl)pyrrolidin-3-ol |
| SMILES | CCn1nncc1N1CC(O)CC1CN(C)C |
| InChI | InChI=1S/C11H21N5O/c1-4-16-11(6-12-13-16)15-8-10(17)5-9(15)7-14(2)3/h6,9-10,17H,4-5,7-8H2,1-3H3 |
| InChIKey | GILHLINDCBORPG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |