C14H26F2N2 — CID 114223582
1-[(3,3-difluorocyclohexyl)methyl]-N-ethylpiperidin-3-amine (PubChem CID 114223582) has the molecular formula C14H26F2N2 and a molecular weight of 260.37 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclohexyl)methyl]-N-ethylpiperidin-3-amine.
| Compound Name | 1-[(3,3-difluorocyclohexyl)methyl]-N-ethylpiperidin-3-amine |
|---|---|
| PubChem CID | 114223582 |
| Molecular Formula | C14H26F2N2 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 1-[(3,3-difluorocyclohexyl)methyl]-N-ethylpiperidin-3-amine |
| SMILES | CCNC1CCCN(CC2CCCC(F)(F)C2)C1 |
| InChI | InChI=1S/C14H26F2N2/c1-2-17-13-6-4-8-18(11-13)10-12-5-3-7-14(15,16)9-12/h12-13,17H,2-11H2,1H3 |
| InChIKey | WHJMBOFFPXZAKH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |