C13H24F2N2 — CID 114225345
1-[(3,3-difluorocyclohexyl)methyl]-3-ethylpiperazine (PubChem CID 114225345) has the molecular formula C13H24F2N2 and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclohexyl)methyl]-3-ethylpiperazine.
| Compound Name | 1-[(3,3-difluorocyclohexyl)methyl]-3-ethylpiperazine |
|---|---|
| PubChem CID | 114225345 |
| Molecular Formula | C13H24F2N2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 1-[(3,3-difluorocyclohexyl)methyl]-3-ethylpiperazine |
| SMILES | CCC1CN(CC2CCCC(F)(F)C2)CCN1 |
| InChI | InChI=1S/C13H24F2N2/c1-2-12-10-17(7-6-16-12)9-11-4-3-5-13(14,15)8-11/h11-12,16H,2-10H2,1H3 |
| InChIKey | YTHDHMHOJUSUFD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |