C13H25F2NO — CID 114223589
2-[(3,3-difluorocyclohexyl)methoxy]-2-ethylbutan-1-amine (PubChem CID 114223589) has the molecular formula C13H25F2NO and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclohexyl)methoxy]-2-ethylbutan-1-amine.
| Compound Name | 2-[(3,3-difluorocyclohexyl)methoxy]-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 114223589 |
| Molecular Formula | C13H25F2NO |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 2-[(3,3-difluorocyclohexyl)methoxy]-2-ethylbutan-1-amine |
| SMILES | CCC(CC)(CN)OCC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H25F2NO/c1-3-12(4-2,10-16)17-9-11-6-5-7-13(14,15)8-11/h11H,3-10,16H2,1-2H3 |
| InChIKey | NMMARAXFCUJHCV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |