C13H21F2N3 — CID 114223797
N-[(3,3-difluorocyclopentyl)methyl]-4-imidazol-1-ylbutan-1-amine (PubChem CID 114223797) has the molecular formula C13H21F2N3 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[(3,3-difluorocyclopentyl)methyl]-4-imidazol-1-ylbutan-1-amine.
| Compound Name | N-[(3,3-difluorocyclopentyl)methyl]-4-imidazol-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 114223797 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-[(3,3-difluorocyclopentyl)methyl]-4-imidazol-1-ylbutan-1-amine |
| SMILES | FC1(F)CCC(CNCCCCn2ccnc2)C1 |
| InChI | InChI=1S/C13H21F2N3/c14-13(15)4-3-12(9-13)10-16-5-1-2-7-18-8-6-17-11-18/h6,8,11-12,16H,1-5,7,9-10H2 |
| InChIKey | XUGWMRJKDKILDH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|