C13H22ClN3 — CID 106122739
N-[(3-chlorocyclohexyl)methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 106122739) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is N-[(3-chlorocyclohexyl)methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[(3-chlorocyclohexyl)methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 106122739 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-[(3-chlorocyclohexyl)methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | ClC1CCCC(CNCCCn2ccnc2)C1 |
| InChI | InChI=1S/C13H22ClN3/c14-13-4-1-3-12(9-13)10-15-5-2-7-17-8-6-16-11-17/h6,8,11-13,15H,1-5,7,9-10H2 |
| InChIKey | NGCWEQHCVVMJHY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|