C9H12F2N2 — CID 126782218
1-[(3,3-difluorocyclopentyl)methyl]imidazole (PubChem CID 126782218) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclopentyl)methyl]imidazole.
| Compound Name | 1-[(3,3-difluorocyclopentyl)methyl]imidazole |
|---|---|
| PubChem CID | 126782218 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-[(3,3-difluorocyclopentyl)methyl]imidazole |
| SMILES | FC1(F)CCC(Cn2ccnc2)C1 |
| InChI | InChI=1S/C9H12F2N2/c10-9(11)2-1-8(5-9)6-13-4-3-12-7-13/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | KQUJJRJFJGAVGP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |