C14H23F2N — CID 114223799
1-cyclohex-3-en-1-yl-N-[(3,3-difluorocyclohexyl)methyl]methanamine (PubChem CID 114223799) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-N-[(3,3-difluorocyclohexyl)methyl]methanamine.
| Compound Name | 1-cyclohex-3-en-1-yl-N-[(3,3-difluorocyclohexyl)methyl]methanamine |
|---|---|
| PubChem CID | 114223799 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-N-[(3,3-difluorocyclohexyl)methyl]methanamine |
| SMILES | FC1(F)CCCC(CNCC2CC=CCC2)C1 |
| InChI | InChI=1S/C14H23F2N/c15-14(16)8-4-7-13(9-14)11-17-10-12-5-2-1-3-6-12/h1-2,12-13,17H,3-11H2 |
| InChIKey | QHSFNJZNRFRROK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|