C11H17F2N — CID 144930001
4-(3,4-difluorocyclohex-2-en-1-yl)piperidine (PubChem CID 144930001) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is 4-(3,4-difluorocyclohex-2-en-1-yl)piperidine.
| Compound Name | 4-(3,4-difluorocyclohex-2-en-1-yl)piperidine |
|---|---|
| PubChem CID | 144930001 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4-(3,4-difluorocyclohex-2-en-1-yl)piperidine |
| SMILES | FC1=CC(C2CCNCC2)CCC1F |
| InChI | InChI=1S/C11H17F2N/c12-10-2-1-9(7-11(10)13)8-3-5-14-6-4-8/h7-10,14H,1-6H2 |
| InChIKey | MFMKBIQKPLMCEW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |