C14H27F2NO — CID 114224951
1-(3,3-difluorocyclohexyl)-3-ethyl-3-methoxypentan-2-amine (PubChem CID 114224951) has the molecular formula C14H27F2NO and a molecular weight of 263.37 g/mol. Its IUPAC name is 1-(3,3-difluorocyclohexyl)-3-ethyl-3-methoxypentan-2-amine.
| Compound Name | 1-(3,3-difluorocyclohexyl)-3-ethyl-3-methoxypentan-2-amine |
|---|---|
| PubChem CID | 114224951 |
| Molecular Formula | C14H27F2NO |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 1-(3,3-difluorocyclohexyl)-3-ethyl-3-methoxypentan-2-amine |
| SMILES | CCC(CC)(OC)C(N)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H27F2NO/c1-4-13(5-2,18-3)12(17)9-11-7-6-8-14(15,16)10-11/h11-12H,4-10,17H2,1-3H3 |
| InChIKey | QAARAQVYTJBOMP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |