C15H29NO — CID 114229896
2-methoxy-N-[(2,2,7,7-tetramethylspiro[2.4]heptan-1-yl)methyl]ethanamine (PubChem CID 114229896) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 2-methoxy-N-[(2,2,7,7-tetramethylspiro[2.4]heptan-1-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(2,2,7,7-tetramethylspiro[2.4]heptan-1-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114229896 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 2-methoxy-N-[(2,2,7,7-tetramethylspiro[2.4]heptan-1-yl)methyl]ethanamine |
| SMILES | COCCNCC1C(C)(C)C12CCCC2(C)C |
| InChI | InChI=1S/C15H29NO/c1-13(2)7-6-8-15(13)12(14(15,3)4)11-16-9-10-17-5/h12,16H,6-11H2,1-5H3 |
| InChIKey | JFIQAZDMJONWLE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|