C11H14N4OS2 — CID 114231528
2-[2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]sulfanylacetamide (PubChem CID 114231528) has the molecular formula C11H14N4OS2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]sulfanylacetamide.
| Compound Name | 2-[2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 114231528 |
| Molecular Formula | C11H14N4OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]sulfanylacetamide |
| SMILES | CCCNc1nc(SCC(N)=O)c2ccsc2n1 |
| InChI | InChI=1S/C11H14N4OS2/c1-2-4-13-11-14-9-7(3-5-17-9)10(15-11)18-6-8(12)16/h3,5H,2,4,6H2,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | ZYCDFONJBXRMRF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |