C10H9F2NO4S — CID 114232173
2-[2-(2,6-difluorophenyl)-2-oxoethyl]sulfonylacetamide (PubChem CID 114232173) has the molecular formula C10H9F2NO4S and a molecular weight of 277.25 g/mol. Its IUPAC name is 2-[2-(2,6-difluorophenyl)-2-oxoethyl]sulfonylacetamide.
| Compound Name | 2-[2-(2,6-difluorophenyl)-2-oxoethyl]sulfonylacetamide |
|---|---|
| PubChem CID | 114232173 |
| Molecular Formula | C10H9F2NO4S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-[2-(2,6-difluorophenyl)-2-oxoethyl]sulfonylacetamide |
| SMILES | NC(=O)CS(=O)(=O)CC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H9F2NO4S/c11-6-2-1-3-7(12)10(6)8(14)4-18(16,17)5-9(13)15/h1-3H,4-5H2,(H2,13,15) |
| InChIKey | HJUPUXUAFFBODB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |