C11H24N2O3S — CID 114232530
N-ethyl-2-[1-(2-methylpropylamino)propan-2-ylsulfonyl]acetamide (PubChem CID 114232530) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is N-ethyl-2-[1-(2-methylpropylamino)propan-2-ylsulfonyl]acetamide.
| Compound Name | N-ethyl-2-[1-(2-methylpropylamino)propan-2-ylsulfonyl]acetamide |
|---|---|
| PubChem CID | 114232530 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-ethyl-2-[1-(2-methylpropylamino)propan-2-ylsulfonyl]acetamide |
| SMILES | CCNC(=O)CS(=O)(=O)C(C)CNCC(C)C |
| InChI | InChI=1S/C11H24N2O3S/c1-5-13-11(14)8-17(15,16)10(4)7-12-6-9(2)3/h9-10,12H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | PJQXMIRUSNZFSY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |