C10H16N2O4S — CID 114232625
2-[[5-(aminomethyl)furan-2-yl]methylsulfonyl]-N-ethylacetamide (PubChem CID 114232625) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 2-[[5-(aminomethyl)furan-2-yl]methylsulfonyl]-N-ethylacetamide.
| Compound Name | 2-[[5-(aminomethyl)furan-2-yl]methylsulfonyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 114232625 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[[5-(aminomethyl)furan-2-yl]methylsulfonyl]-N-ethylacetamide |
| SMILES | CCNC(=O)CS(=O)(=O)Cc1ccc(CN)o1 |
| InChI | InChI=1S/C10H16N2O4S/c1-2-12-10(13)7-17(14,15)6-9-4-3-8(5-11)16-9/h3-4H,2,5-7,11H2,1H3,(H,12,13) |
| InChIKey | BUZVUMXCLMLMTR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |