About 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile
7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 11423738) has the molecular formula C7H5N5
and a molecular weight of 159.15 g/mol. Its IUPAC name is 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile.
Molecular Properties
| Compound Name | 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
| PubChem CID | 11423738 |
| Molecular Formula | C7H5N5 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
| SMILES | Cc1c(C#N)cnc2ncnn12 |
| InChI | InChI=1S/C7H5N5/c1-5-6(2-8)3-9-7-10-4-11-12(5)7/h3-4H,1H3 |
| InChIKey | OWWUTUKAPCGJOF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile?
The IUPAC name of 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile (CID 11423738) is 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile.
What is the SMILES notation for 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile?
The canonical SMILES for 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile is Cc1c(C#N)cnc2ncnn12.
What is the InChIKey of 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile?
The InChIKey is OWWUTUKAPCGJOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5/c1-5-6(2-8)3-9-7-10-4-11-12(5)7/h3-4H,1H3.
What are the key properties of 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile?
7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile has a molecular weight of 159.15 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile is sourced from PubChem (CID 11423738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).