C14H22F2O2 — CID 114241894
2-(3,3-difluorocyclohexyl)-1-(3-methyloxan-4-yl)ethanone (PubChem CID 114241894) has the molecular formula C14H22F2O2 and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-1-(3-methyloxan-4-yl)ethanone.
| Compound Name | 2-(3,3-difluorocyclohexyl)-1-(3-methyloxan-4-yl)ethanone |
|---|---|
| PubChem CID | 114241894 |
| Molecular Formula | C14H22F2O2 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-1-(3-methyloxan-4-yl)ethanone |
| SMILES | CC1COCCC1C(=O)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H22F2O2/c1-10-9-18-6-4-12(10)13(17)7-11-3-2-5-14(15,16)8-11/h10-12H,2-9H2,1H3 |
| InChIKey | GJISRADQYRCTRX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |