About but-3-enyl 3-phenylpropan(18O)oate
but-3-enyl 3-phenylpropan(18O)oate (PubChem CID 11424293) has the molecular formula C13H16O2
and a molecular weight of 206.27 g/mol. Its IUPAC name is but-3-enyl 3-phenylpropan(18O)oate.
Molecular Properties
| Compound Name | but-3-enyl 3-phenylpropan(18O)oate |
| PubChem CID | 11424293 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | but-3-enyl 3-phenylpropan(18O)oate |
| SMILES | C=CCCOC(=[18O])CCc1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12/h2,4-8H,1,3,9-11H2/i14+2 |
| InChIKey | DGFLAVLHCBNESJ-HKGQFRNVSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 3-phenylpropan(18O)oate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 3-phenylpropan(18O)oate?
The IUPAC name of but-3-enyl 3-phenylpropan(18O)oate (CID 11424293) is but-3-enyl 3-phenylpropan(18O)oate.
What is the SMILES notation for but-3-enyl 3-phenylpropan(18O)oate?
The canonical SMILES for but-3-enyl 3-phenylpropan(18O)oate is C=CCCOC(=[18O])CCc1ccccc1.
What is the InChIKey of but-3-enyl 3-phenylpropan(18O)oate?
The InChIKey is DGFLAVLHCBNESJ-HKGQFRNVSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12/h2,4-8H,1,3,9-11H2/i14+2.
What are the key properties of but-3-enyl 3-phenylpropan(18O)oate?
but-3-enyl 3-phenylpropan(18O)oate has a molecular weight of 206.27 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 3-phenylpropan(18O)oate is sourced from PubChem (CID 11424293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).