C10H11FN4O2S — CID 114244719
N-(3-amino-6-fluoro-2-methylphenyl)-1H-imidazole-5-sulfonamide (PubChem CID 114244719) has the molecular formula C10H11FN4O2S and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(3-amino-6-fluoro-2-methylphenyl)-1H-imidazole-5-sulfonamide.
| Compound Name | N-(3-amino-6-fluoro-2-methylphenyl)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 114244719 |
| Molecular Formula | C10H11FN4O2S |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | N-(3-amino-6-fluoro-2-methylphenyl)-1H-imidazole-5-sulfonamide |
| SMILES | Cc1c(N)ccc(F)c1NS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C10H11FN4O2S/c1-6-8(12)3-2-7(11)10(6)15-18(16,17)9-4-13-5-14-9/h2-5,15H,12H2,1H3,(H,13,14) |
| InChIKey | FXIKFLIENOHSQA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|