C16H21BrO — CID 114245785
2-(2-bicyclo[2.2.1]heptanyl)-1-(4-bromophenyl)propan-2-ol (PubChem CID 114245785) has the molecular formula C16H21BrO and a molecular weight of 309.25 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-bromophenyl)propan-2-ol.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-bromophenyl)propan-2-ol |
|---|---|
| PubChem CID | 114245785 |
| Molecular Formula | C16H21BrO |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-bromophenyl)propan-2-ol |
| SMILES | CC(O)(Cc1ccc(Br)cc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H21BrO/c1-16(18,10-11-3-6-14(17)7-4-11)15-9-12-2-5-13(15)8-12/h3-4,6-7,12-13,15,18H,2,5,8-10H2,1H3 |
| InChIKey | PPRNKJZLXCQRRV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |