C16H22BrN — CID 114246245
2-(2-bicyclo[2.2.1]heptanyl)-3-(2-bromophenyl)propan-1-amine (PubChem CID 114246245) has the molecular formula C16H22BrN and a molecular weight of 308.26 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-3-(2-bromophenyl)propan-1-amine.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-3-(2-bromophenyl)propan-1-amine |
|---|---|
| PubChem CID | 114246245 |
| Molecular Formula | C16H22BrN |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-3-(2-bromophenyl)propan-1-amine |
| SMILES | NCC(Cc1ccccc1Br)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H22BrN/c17-16-4-2-1-3-13(16)9-14(10-18)15-8-11-5-6-12(15)7-11/h1-4,11-12,14-15H,5-10,18H2 |
| InChIKey | AQGYTXUBPRJICF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |