C14H21BrFN — CID 114246520
1-(2-bromo-3-fluorophenyl)-3-methylheptan-2-amine (PubChem CID 114246520) has the molecular formula C14H21BrFN and a molecular weight of 302.23 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-3-methylheptan-2-amine.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-3-methylheptan-2-amine |
|---|---|
| PubChem CID | 114246520 |
| Molecular Formula | C14H21BrFN |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-3-methylheptan-2-amine |
| SMILES | CCCCC(C)C(N)Cc1cccc(F)c1Br |
| InChI | InChI=1S/C14H21BrFN/c1-3-4-6-10(2)13(17)9-11-7-5-8-12(16)14(11)15/h5,7-8,10,13H,3-4,6,9,17H2,1-2H3 |
| InChIKey | BIUCBJOOQAAPCY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |