C14H22N2O2S — CID 114248563
ethyl 2-amino-3-(3-ethylsulfanylpropylamino)benzoate (PubChem CID 114248563) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is ethyl 2-amino-3-(3-ethylsulfanylpropylamino)benzoate.
| Compound Name | ethyl 2-amino-3-(3-ethylsulfanylpropylamino)benzoate |
|---|---|
| PubChem CID | 114248563 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | ethyl 2-amino-3-(3-ethylsulfanylpropylamino)benzoate |
| SMILES | CCOC(=O)c1cccc(NCCCSCC)c1N |
| InChI | InChI=1S/C14H22N2O2S/c1-3-18-14(17)11-7-5-8-12(13(11)15)16-9-6-10-19-4-2/h5,7-8,16H,3-4,6,9-10,15H2,1-2H3 |
| InChIKey | NTCAMMSJMSGPAV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|