C15H18N2O2S — CID 115546612
ethyl 2-amino-3-[(4-methylthiophen-3-yl)methylamino]benzoate (PubChem CID 115546612) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is ethyl 2-amino-3-[(4-methylthiophen-3-yl)methylamino]benzoate.
| Compound Name | ethyl 2-amino-3-[(4-methylthiophen-3-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 115546612 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | ethyl 2-amino-3-[(4-methylthiophen-3-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NCc2cscc2C)c1N |
| InChI | InChI=1S/C15H18N2O2S/c1-3-19-15(18)12-5-4-6-13(14(12)16)17-7-11-9-20-8-10(11)2/h4-6,8-9,17H,3,7,16H2,1-2H3 |
| InChIKey | LAMDARQMYJCIKI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|