C14H15BrN2O2S — CID 115546280
ethyl 2-amino-3-[(4-bromothiophen-2-yl)methylamino]benzoate (PubChem CID 115546280) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is ethyl 2-amino-3-[(4-bromothiophen-2-yl)methylamino]benzoate.
| Compound Name | ethyl 2-amino-3-[(4-bromothiophen-2-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 115546280 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | ethyl 2-amino-3-[(4-bromothiophen-2-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NCc2cc(Br)cs2)c1N |
| InChI | InChI=1S/C14H15BrN2O2S/c1-2-19-14(18)11-4-3-5-12(13(11)16)17-7-10-6-9(15)8-20-10/h3-6,8,17H,2,7,16H2,1H3 |
| InChIKey | FNRRTMCZLBDFSS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|