C13H16N4O3 — CID 115545666
ethyl 2-amino-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]benzoate (PubChem CID 115545666) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is ethyl 2-amino-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]benzoate.
| Compound Name | ethyl 2-amino-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 115545666 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | ethyl 2-amino-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NCc2nc(C)no2)c1N |
| InChI | InChI=1S/C13H16N4O3/c1-3-19-13(18)9-5-4-6-10(12(9)14)15-7-11-16-8(2)17-20-11/h4-6,15H,3,7,14H2,1-2H3 |
| InChIKey | STDYZMAWUWGGCU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|