C11H18N4O3S — CID 114251107
(2R)-2-[(1-ethylpyrazol-3-yl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 114251107) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is (2R)-2-[(1-ethylpyrazol-3-yl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(1-ethylpyrazol-3-yl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 114251107 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2R)-2-[(1-ethylpyrazol-3-yl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CCn1ccc(NC(=O)N[C@H](CCSC)C(=O)O)n1 |
| InChI | InChI=1S/C11H18N4O3S/c1-3-15-6-4-9(14-15)13-11(18)12-8(10(16)17)5-7-19-2/h4,6,8H,3,5,7H2,1-2H3,(H,16,17)(H2,12,13,14,18)/t8-/m1/s1 |
| InChIKey | GIWINIAICNMOBE-MRVPVSSYSA-N |
| XLogP | 1.23 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |