C15H20N2O2 — CID 11425458
tert-butyl N-(4-methyl-N-prop-2-ynylanilino)carbamate (PubChem CID 11425458) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is tert-butyl N-(4-methyl-N-prop-2-ynylanilino)carbamate.
| Compound Name | tert-butyl N-(4-methyl-N-prop-2-ynylanilino)carbamate |
|---|---|
| PubChem CID | 11425458 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | tert-butyl N-(4-methyl-N-prop-2-ynylanilino)carbamate |
| SMILES | C#CCN(NC(=O)OC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20N2O2/c1-6-11-17(13-9-7-12(2)8-10-13)16-14(18)19-15(3,4)5/h1,7-10H,11H2,2-5H3,(H,16,18) |
| InChIKey | BPGXSEIXXOPVEL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|