C11H13ClN4O — CID 114255384
3-chloro-1-N-(5-methoxy-1-methylpyrazol-3-yl)benzene-1,2-diamine (PubChem CID 114255384) has the molecular formula C11H13ClN4O and a molecular weight of 252.71 g/mol. Its IUPAC name is 3-chloro-1-N-(5-methoxy-1-methylpyrazol-3-yl)benzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-(5-methoxy-1-methylpyrazol-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114255384 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-chloro-1-N-(5-methoxy-1-methylpyrazol-3-yl)benzene-1,2-diamine |
| SMILES | COc1cc(Nc2cccc(Cl)c2N)nn1C |
| InChI | InChI=1S/C11H13ClN4O/c1-16-10(17-2)6-9(15-16)14-8-5-3-4-7(12)11(8)13/h3-6H,13H2,1-2H3,(H,14,15) |
| InChIKey | VNEOFUWDSKWGAB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|