C10H17N7O — CID 114256066
N-[[1-(2-aminoethyl)triazol-4-yl]methyl]-5-methoxy-1-methylpyrazol-3-amine (PubChem CID 114256066) has the molecular formula C10H17N7O and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[[1-(2-aminoethyl)triazol-4-yl]methyl]-5-methoxy-1-methylpyrazol-3-amine.
| Compound Name | N-[[1-(2-aminoethyl)triazol-4-yl]methyl]-5-methoxy-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 114256066 |
| Molecular Formula | C10H17N7O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[[1-(2-aminoethyl)triazol-4-yl]methyl]-5-methoxy-1-methylpyrazol-3-amine |
| SMILES | COc1cc(NCc2cn(CCN)nn2)nn1C |
| InChI | InChI=1S/C10H17N7O/c1-16-10(18-2)5-9(14-16)12-6-8-7-17(4-3-11)15-13-8/h5,7H,3-4,6,11H2,1-2H3,(H,12,14) |
| InChIKey | SGNQOIQXJDDHGB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |