C11H11ClIN5 — CID 114261277
N-[[1-(2-chloro-5-iodophenyl)tetrazol-5-yl]methyl]cyclopropanamine (PubChem CID 114261277) has the molecular formula C11H11ClIN5 and a molecular weight of 375.60 g/mol. Its IUPAC name is N-[[1-(2-chloro-5-iodophenyl)tetrazol-5-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-(2-chloro-5-iodophenyl)tetrazol-5-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114261277 |
| Molecular Formula | C11H11ClIN5 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | N-[[1-(2-chloro-5-iodophenyl)tetrazol-5-yl]methyl]cyclopropanamine |
| SMILES | Clc1ccc(I)cc1-n1nnnc1CNC1CC1 |
| InChI | InChI=1S/C11H11ClIN5/c12-9-4-1-7(13)5-10(9)18-11(15-16-17-18)6-14-8-2-3-8/h1,4-5,8,14H,2-3,6H2 |
| InChIKey | LTQODAOUCUVNTR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|