C12H14FN5 — CID 62737024
N-[[1-(4-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]cyclopropanamine (PubChem CID 62737024) has the molecular formula C12H14FN5 and a molecular weight of 247.28 g/mol. Its IUPAC name is N-[[1-(4-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-(4-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62737024 |
| Molecular Formula | C12H14FN5 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-[[1-(4-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]cyclopropanamine |
| SMILES | Cc1cc(F)ccc1-n1nnnc1CNC1CC1 |
| InChI | InChI=1S/C12H14FN5/c1-8-6-9(13)2-5-11(8)18-12(15-16-17-18)7-14-10-3-4-10/h2,5-6,10,14H,3-4,7H2,1H3 |
| InChIKey | YRRWUDFWIGJQFK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |