C11H15ClN2O2S — CID 114264577
4-amino-2-chloro-N-pent-4-enylbenzenesulfonamide (PubChem CID 114264577) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 4-amino-2-chloro-N-pent-4-enylbenzenesulfonamide.
| Compound Name | 4-amino-2-chloro-N-pent-4-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 114264577 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-amino-2-chloro-N-pent-4-enylbenzenesulfonamide |
| SMILES | C=CCCCNS(=O)(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C11H15ClN2O2S/c1-2-3-4-7-14-17(15,16)11-6-5-9(13)8-10(11)12/h2,5-6,8,14H,1,3-4,7,13H2 |
| InChIKey | BFTKTZIWRRIGFL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|