C12H18BrN3O2 — CID 114266325
2-[2-(3-bromo-4-methylanilino)ethoxy]-N'-hydroxypropanimidamide (PubChem CID 114266325) has the molecular formula C12H18BrN3O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is 2-[2-(3-bromo-4-methylanilino)ethoxy]-N'-hydroxypropanimidamide.
| Compound Name | 2-[2-(3-bromo-4-methylanilino)ethoxy]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 114266325 |
| Molecular Formula | C12H18BrN3O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[2-(3-bromo-4-methylanilino)ethoxy]-N'-hydroxypropanimidamide |
| SMILES | Cc1ccc(NCCOC(C)/C(N)=N/O)cc1Br |
| InChI | InChI=1S/C12H18BrN3O2/c1-8-3-4-10(7-11(8)13)15-5-6-18-9(2)12(14)16-17/h3-4,7,9,15,17H,5-6H2,1-2H3,(H2,14,16) |
| InChIKey | FPIYMTBQJFONAW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|